Products 24812-93-9
CAS 24812-93-9 appears in our catalog under these names: Methyl 3-amino-4-ethylbenzoate, 95%, Methyl 3-amino-4-ethylbenzoate, 98%, Methyl 3–amino–4–ethylbenzoate, Methyl 3-amino-4-ethylbenzoate, Methyl 3-amino-4-ethylbenzoate 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 50mg, 2,5g, 100mg, 5g, 500mg, 2.5g.
Methyl 3-amino-4-ethylbenzoate (CAS 24812-93-9) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: methyl 3-amino-4-ethylbenzoate. InChIKey: ADYSZCGUXDZDGN-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | methyl 3-amino-4-ethylbenzoate |
| InChIKey | ADYSZCGUXDZDGN-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=C(C=C1)C(=O)OC)N |
Computed by PubChem (NCBI)