CAS 2483824-33-3 appears in our catalog under these names: L–Methionine–13C,d5, L-Methionine-13C,d5, 98%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 1 mg, 5 mg, 10 mg.
(2S)-2-amino-2,3,3,4,4-pentadeuterio-4-(113C)methylsulfanylbutanoic acid (CAS 2483824-33-3) is a chemical compound with the molecular formula C5H11NO2S and a molecular weight of 155.24 g/mol. IUPAC name: (2S)-2-amino-2,3,3,4,4-pentadeuterio-4-(113C)methylsulfanylbutanoic acid. InChIKey: FFEARJCKVFRZRR-MMGKRZGSSA-N.
| Molecular formula | C5H11NO2S |
|---|---|
| Molecular weight | 155.24 g/mol |
| IUPAC name | (2S)-2-amino-2,3,3,4,4-pentadeuterio-4-(113C)methylsulfanylbutanoic acid |
| InChIKey | FFEARJCKVFRZRR-MMGKRZGSSA-N |
| SMILES | [2H][C@@](C(=O)O)(C([2H])([2H])C([2H])([2H])S[13CH3])N |
Computed by PubChem (NCBI)