CAS 2486914-15-0 is the registry number for MAO-B-IN-40. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[(2,3-dihydroxyphenyl)methylideneamino]-2-(1H-indol-3-yl)acetamide (CAS 2486914-15-0) is a chemical compound with the molecular formula C17H15N3O3 and a molecular weight of 309.32 g/mol. IUPAC name: N-[(2,3-dihydroxyphenyl)methylideneamino]-2-(1H-indol-3-yl)acetamide. InChIKey: SIMPRQGWMKSJNS-UHFFFAOYSA-N.
| Molecular formula | C17H15N3O3 |
|---|---|
| Molecular weight | 309.32 g/mol |
| IUPAC name | N-[(2,3-dihydroxyphenyl)methylideneamino]-2-(1H-indol-3-yl)acetamide |
| InChIKey | SIMPRQGWMKSJNS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CC(=O)NN=CC3=C(C(=CC=C3)O)O |
Computed by PubChem (NCBI)