CAS 5156-83-2 appears in our catalog under these names: 2-Methyl-6-acetylnaphthalene, 98%, 1-(6-Methylnaphthalen-2-yl)ethanone 95%, 1-(6-Methyl-2-naphthalenyl)ethanone, 98%, 98%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(6-methylnaphthalen-2-yl)ethanone (CAS 5156-83-2) is a chemical compound with the molecular formula C13H12O and a molecular weight of 184.23 g/mol. IUPAC name: 1-(6-methylnaphthalen-2-yl)ethanone. InChIKey: SPAYGOAEIJHIDE-UHFFFAOYSA-N.
| Molecular formula | C13H12O |
|---|---|
| Molecular weight | 184.23 g/mol |
| IUPAC name | 1-(6-methylnaphthalen-2-yl)ethanone |
| InChIKey | SPAYGOAEIJHIDE-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C=C(C=C2)C(=O)C |
Computed by PubChem (NCBI)