CAS 2488951-95-5 is the registry number for 5-Bromoisoquinolin-7-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromoisoquinolin-7-ol (CAS 2488951-95-5) is a chemical compound with the molecular formula C9H6BrNO and a molecular weight of 224.05 g/mol. IUPAC name: 5-bromoisoquinolin-7-ol. InChIKey: AXWTYRHMLBXCSG-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO |
|---|---|
| Molecular weight | 224.05 g/mol |
| IUPAC name | 5-bromoisoquinolin-7-ol |
| InChIKey | AXWTYRHMLBXCSG-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=C1C(=CC(=C2)O)Br |
Computed by PubChem (NCBI)