CAS 248920-11-8 appears in our catalog under these names: 2–(2–Bromo–3–methylphenyl)acetic acid, 2-(2-bromo-3-methylphenyl)acetic acid, 2-(2-Bromo-3-methylphenyl)acetic acid, 97%, 97%, 2-(2-BROMO-3-METHYLPHENYL)ACETIC ACID, 95%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 2,5g, 250mg, 1g, 5g.
2-(2-bromo-3-methylphenyl)acetic acid (CAS 248920-11-8) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. IUPAC name: 2-(2-bromo-3-methylphenyl)acetic acid. InChIKey: JZMWDWZVHXNEEF-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO2 |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | 2-(2-bromo-3-methylphenyl)acetic acid |
| InChIKey | JZMWDWZVHXNEEF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)CC(=O)O)Br |
Computed by PubChem (NCBI)