Products 2490-91-7
CAS 2490-91-7 appears in our catalog under these names: 3-Deoxy-D-glucose, >95% (HPLC), (2R,4S,5R)-2,4,5,6-Tetrahydroxyhexanal, 95+%, 3-Deoxy-D-glucose, (2R,4S,5R)-2,4,5,6-Tetrahydroxyhexanal, ≥98%, ≥98%. Offered by: TRC, AmBeed, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 50mg, 250mg, 1g, 25mg, 10mg, 5mg, 25 mg.
(2R,4S,5R)-2,4,5,6-tetrahydroxyhexanal (CAS 2490-91-7) is a chemical compound with the molecular formula C6H12O5 and a molecular weight of 164.16 g/mol. IUPAC name: (2R,4S,5R)-2,4,5,6-tetrahydroxyhexanal. InChIKey: KDSPLKNONIUZSZ-NGJCXOISSA-N.
| Molecular formula | C6H12O5 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | (2R,4S,5R)-2,4,5,6-tetrahydroxyhexanal |
| InChIKey | KDSPLKNONIUZSZ-NGJCXOISSA-N |
| SMILES | C([C@H](C=O)O)[C@@H]([C@@H](CO)O)O |
Computed by PubChem (NCBI)