CAS 5517-48-6 is the registry number for (2S,4S,5R)-2,4,5,6-Tetrahydroxyhexanal, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,4S,5R)-2,4,5,6-tetrahydroxyhexanal (CAS 5517-48-6) is a chemical compound with the molecular formula C6H12O5 and a molecular weight of 164.16 g/mol. IUPAC name: (2S,4S,5R)-2,4,5,6-tetrahydroxyhexanal. InChIKey: KDSPLKNONIUZSZ-HCWXCVPCSA-N.
| Molecular formula | C6H12O5 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | (2S,4S,5R)-2,4,5,6-tetrahydroxyhexanal |
| InChIKey | KDSPLKNONIUZSZ-HCWXCVPCSA-N |
| SMILES | C([C@@H](C=O)O)[C@@H]([C@@H](CO)O)O |
Computed by PubChem (NCBI)