Products 2490412-71-8

CAS 2490412-71-8 appears in our catalog under these names: 4-(2-Aminophenyl)-4-oxobutanoic acid hydrochloride, 4-(2-Aminophenyl)-4-oxobutanoic acid hydrochloride, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-(2-aminophenyl)-4-oxobutanoic acid;hydrochloride (CAS 2490412-71-8) is a chemical compound with the molecular formula C10H12ClNO3 and a molecular weight of 229.66 g/mol. IUPAC name: 4-(2-aminophenyl)-4-oxobutanoic acid;hydrochloride. InChIKey: QXTYCKGXWPSYPB-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12ClNO3
Molecular weight229.66 g/mol
IUPAC name4-(2-aminophenyl)-4-oxobutanoic acid;hydrochloride
InChIKeyQXTYCKGXWPSYPB-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(=O)CCC(=O)O)N.Cl

Computed by PubChem (NCBI)