Products 24950-44-5
CAS 24950-44-5 appears in our catalog under these names: 1,2-Di(pyridin-3-yl)ethene, 95%, 95%, 1,2-Di(pyridin-3-yl)ethene, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
3-(2-pyridin-3-ylethenyl)pyridine (CAS 24950-44-5) is a chemical compound with the molecular formula C12H10N2 and a molecular weight of 182.22 g/mol. IUPAC name: 3-(2-pyridin-3-ylethenyl)pyridine. InChIKey: LJUIBUKIAISMFU-UHFFFAOYSA-N.
| Molecular formula | C12H10N2 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 3-(2-pyridin-3-ylethenyl)pyridine |
| InChIKey | LJUIBUKIAISMFU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C=CC2=CN=CC=C2 |
Computed by PubChem (NCBI)