Products 2496497-79-9
CAS 2496497-79-9 is the registry number for (1S,4S)-4-amino-2,2-difluoro-cyclopentanecarboxylic acid,hydrochloride, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Trans-(1S,4S)-4-amino-2,2-difluorocyclopentane-1-carboxylic acid;hydrochloride (CAS 2496497-79-9) is a chemical compound with the molecular formula C6H10ClF2NO2 and a molecular weight of 201.60 g/mol. IUPAC name: trans-(1S,4S)-4-amino-2,2-difluorocyclopentane-1-carboxylic acid;hydrochloride. InChIKey: UISKAKPCYBBZBR-MMALYQPHSA-N.
| Molecular formula | C6H10ClF2NO2 |
|---|---|
| Molecular weight | 201.60 g/mol |
| IUPAC name | trans-(1S,4S)-4-amino-2,2-difluorocyclopentane-1-carboxylic acid;hydrochloride |
| InChIKey | UISKAKPCYBBZBR-MMALYQPHSA-N |
| SMILES | C1[C@@H](CC([C@@H]1C(=O)O)(F)F)N.Cl |
Computed by PubChem (NCBI)