Products 2502294-55-3
CAS 2502294-55-3 is the registry number for (E/Z)-OSM-SMI-10B. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-3-[4,5-bis(1,3-benzodioxol-5-yl)furan-2-yl]prop-2-enoic acid (CAS 2502294-55-3) is a chemical compound with the molecular formula C21H14O7 and a molecular weight of 378.3 g/mol. IUPAC name: (E)-3-[4,5-bis(1,3-benzodioxol-5-yl)furan-2-yl]prop-2-enoic acid. InChIKey: KCTZPNCRBRJVBH-ZZXKWVIFSA-N.
| Molecular formula | C21H14O7 |
|---|---|
| Molecular weight | 378.3 g/mol |
| IUPAC name | (E)-3-[4,5-bis(1,3-benzodioxol-5-yl)furan-2-yl]prop-2-enoic acid |
| InChIKey | KCTZPNCRBRJVBH-ZZXKWVIFSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C3=C(OC(=C3)/C=C/C(=O)O)C4=CC5=C(C=C4)OCO5 |
Computed by PubChem (NCBI)