Products 250275-03-7

CAS 250275-03-7 is the registry number for rac-tert-Butyl N-((3R,4S)-4-cyclopropylpyrrolidin-3-yl)carbamate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl N-(4-cyclopropylpyrrolidin-3-yl)carbamate (CAS 250275-03-7) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl N-(4-cyclopropylpyrrolidin-3-yl)carbamate. InChIKey: RYNAGLMDQOVNMK-UHFFFAOYSA-N.

Identity
Molecular formulaC12H22N2O2
Molecular weight226.32 g/mol
IUPAC nametert-butyl N-(4-cyclopropylpyrrolidin-3-yl)carbamate
InChIKeyRYNAGLMDQOVNMK-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1CNCC1C2CC2

Computed by PubChem (NCBI)