CAS 250339-42-5 is the registry number for 3,3,3-Trifluoro-2-(1H-indol-3-yl)propanoic acid, 95%. Offered by: Ambeed. Available pack sizes: 100mg.
3,3,3-trifluoro-2-(1H-indol-3-yl)propanoic acid (CAS 250339-42-5) is a chemical compound with the molecular formula C11H8F3NO2 and a molecular weight of 243.18 g/mol. IUPAC name: 3,3,3-trifluoro-2-(1H-indol-3-yl)propanoic acid. InChIKey: GFOVJSGKTMFCRY-UHFFFAOYSA-N.
| Molecular formula | C11H8F3NO2 |
|---|---|
| Molecular weight | 243.18 g/mol |
| IUPAC name | 3,3,3-trifluoro-2-(1H-indol-3-yl)propanoic acid |
| InChIKey | GFOVJSGKTMFCRY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C(C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)