Products 250339-42-5

CAS 250339-42-5 is the registry number for 3,3,3-Trifluoro-2-(1H-indol-3-yl)propanoic acid, 95%. Offered by: Ambeed. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

3,3,3-trifluoro-2-(1H-indol-3-yl)propanoic acid (CAS 250339-42-5) is a chemical compound with the molecular formula C11H8F3NO2 and a molecular weight of 243.18 g/mol. IUPAC name: 3,3,3-trifluoro-2-(1H-indol-3-yl)propanoic acid. InChIKey: GFOVJSGKTMFCRY-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8F3NO2
Molecular weight243.18 g/mol
IUPAC name3,3,3-trifluoro-2-(1H-indol-3-yl)propanoic acid
InChIKeyGFOVJSGKTMFCRY-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=CN2)C(C(=O)O)C(F)(F)F

Computed by PubChem (NCBI)