CAS 2506049-22-3 is the registry number for 7-Bromo-2,4-dimethoxyquinazoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-2,4-dimethoxyquinazoline (CAS 2506049-22-3) is a chemical compound with the molecular formula C10H9BrN2O2 and a molecular weight of 269.09 g/mol. IUPAC name: 7-bromo-2,4-dimethoxyquinazoline. InChIKey: TTXHSVYTYAJUPW-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O2 |
|---|---|
| Molecular weight | 269.09 g/mol |
| IUPAC name | 7-bromo-2,4-dimethoxyquinazoline |
| InChIKey | TTXHSVYTYAJUPW-UHFFFAOYSA-N |
| SMILES | COC1=NC(=NC2=C1C=CC(=C2)Br)OC |
Computed by PubChem (NCBI)