CAS 250674-98-7 is the registry number for Trimethyl-(1,2,4)triazolo(1,5-a)pyrimidine-2-thiol, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5,6,7-trimethyl-1H-[1,2,4]triazolo[1,5-a]pyrimidine-2-thione (CAS 250674-98-7) is a chemical compound with the molecular formula C8H10N4S and a molecular weight of 194.26 g/mol. IUPAC name: 5,6,7-trimethyl-1H-[1,2,4]triazolo[1,5-a]pyrimidine-2-thione. InChIKey: WOGNXXSMPUSFMA-UHFFFAOYSA-N.
| Molecular formula | C8H10N4S |
|---|---|
| Molecular weight | 194.26 g/mol |
| IUPAC name | 5,6,7-trimethyl-1H-[1,2,4]triazolo[1,5-a]pyrimidine-2-thione |
| InChIKey | WOGNXXSMPUSFMA-UHFFFAOYSA-N |
| SMILES | CC1=C(N2C(=NC(=S)N2)N=C1C)C |
Computed by PubChem (NCBI)