CAS 956364-00-4 is the registry number for 4-(1,3-Dimethyl-1H-pyrazol-4-yl)-1,3-thiazol-2-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(1,3-dimethylpyrazol-4-yl)-1,3-thiazol-2-amine (CAS 956364-00-4) is a chemical compound with the molecular formula C8H10N4S and a molecular weight of 194.26 g/mol. IUPAC name: 4-(1,3-dimethylpyrazol-4-yl)-1,3-thiazol-2-amine. InChIKey: BAZMMNWMHWSUPN-UHFFFAOYSA-N.
| Molecular formula | C8H10N4S |
|---|---|
| Molecular weight | 194.26 g/mol |
| IUPAC name | 4-(1,3-dimethylpyrazol-4-yl)-1,3-thiazol-2-amine |
| InChIKey | BAZMMNWMHWSUPN-UHFFFAOYSA-N |
| SMILES | CC1=NN(C=C1C2=CSC(=N2)N)C |
Computed by PubChem (NCBI)