CAS 929975-79-1 is the registry number for 4-Methyl-5-(1-methyl-1H-imidazol-2-yl)-2,3-dihydro-1,3-thiazol-2-imine. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 0,5g, 50mg.
4-methyl-5-(1-methylimidazol-2-yl)-1,3-thiazol-2-amine (CAS 929975-79-1) is a chemical compound with the molecular formula C8H10N4S and a molecular weight of 194.26 g/mol. IUPAC name: 4-methyl-5-(1-methylimidazol-2-yl)-1,3-thiazol-2-amine. InChIKey: MHYCRLDCEBMUQM-UHFFFAOYSA-N.
| Molecular formula | C8H10N4S |
|---|---|
| Molecular weight | 194.26 g/mol |
| IUPAC name | 4-methyl-5-(1-methylimidazol-2-yl)-1,3-thiazol-2-amine |
| InChIKey | MHYCRLDCEBMUQM-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)N)C2=NC=CN2C |
Computed by PubChem (NCBI)