CAS 25068-95-5 is the registry number for 3-Methoxy-4-methylamphetamine Hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 250mg.
1-(3-methoxy-4-methylphenyl)propan-2-amine;hydrochloride (CAS 25068-95-5) is a chemical compound with the molecular formula C11H18ClNO and a molecular weight of 215.72 g/mol. IUPAC name: 1-(3-methoxy-4-methylphenyl)propan-2-amine;hydrochloride. InChIKey: XHCLBSGALFHVFS-UHFFFAOYSA-N.
| Molecular formula | C11H18ClNO |
|---|---|
| Molecular weight | 215.72 g/mol |
| IUPAC name | 1-(3-methoxy-4-methylphenyl)propan-2-amine;hydrochloride |
| InChIKey | XHCLBSGALFHVFS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)CC(C)N)OC.Cl |
Computed by PubChem (NCBI)