Products 2508138-40-5
CAS 2508138-40-5 is the registry number for rac cis-Loxoprofen-d3 Alcohol. Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
2-[4-[[(1R,2R)-1,3,3-trideuterio-2-hydroxycyclopentyl]methyl]phenyl]propanoic acid (CAS 2508138-40-5) is a chemical compound with the molecular formula C15H20O3 and a molecular weight of 251.34 g/mol. IUPAC name: 2-[4-[[(1R,2R)-1,3,3-trideuterio-2-hydroxycyclopentyl]methyl]phenyl]propanoic acid. InChIKey: SHAHPWSYJFYMRX-HSGQILFISA-N.
| Molecular formula | C15H20O3 |
|---|---|
| Molecular weight | 251.34 g/mol |
| IUPAC name | 2-[4-[[(1R,2R)-1,3,3-trideuterio-2-hydroxycyclopentyl]methyl]phenyl]propanoic acid |
| InChIKey | SHAHPWSYJFYMRX-HSGQILFISA-N |
| SMILES | [2H][C@@]1(CCC([C@H]1O)([2H])[2H])CC2=CC=C(C=C2)C(C)C(=O)O |
Computed by PubChem (NCBI)