CAS 371753-20-7 appears in our catalog under these names: Loxoprofen Impurity 30, cis-Hydroxy Loxoprofen, Loxoprofen Impurity 23(Mixture of Diastereomers), rac cis-Loxoprofen Alcohol, >95% (HPLC), rel-2-(4-(((1R,2R)-2-Hydroxycyclopentyl)methyl)phenyl)propanoic acid 98%. Offered by: Chemat Brand, Hubei YoungXin, TRC, Ambeed. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 2,5mg.
2-[4-[[(1R,2R)-2-hydroxycyclopentyl]methyl]phenyl]propanoic acid (CAS 371753-20-7) is a chemical compound with the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. IUPAC name: 2-[4-[[(1R,2R)-2-hydroxycyclopentyl]methyl]phenyl]propanoic acid. InChIKey: SHAHPWSYJFYMRX-WDEVSDKISA-N.
| Molecular formula | C15H20O3 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | 2-[4-[[(1R,2R)-2-hydroxycyclopentyl]methyl]phenyl]propanoic acid |
| InChIKey | SHAHPWSYJFYMRX-WDEVSDKISA-N |
| SMILES | CC(C1=CC=C(C=C1)C[C@H]2CCC[C@H]2O)C(=O)O |
Computed by PubChem (NCBI)