Products 88378-21-6

CAS 88378-21-6 is the registry number for Loxoprofen Impurity 93(trans-Hydroxy Loxoprofen). Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[4-[(2-hydroxycyclopentyl)methyl]phenyl]propanoic acid (CAS 88378-21-6) is a chemical compound with the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. IUPAC name: 2-[4-[(2-hydroxycyclopentyl)methyl]phenyl]propanoic acid. InChIKey: SHAHPWSYJFYMRX-UHFFFAOYSA-N.

Identity
Molecular formulaC15H20O3
Molecular weight248.32 g/mol
IUPAC name2-[4-[(2-hydroxycyclopentyl)methyl]phenyl]propanoic acid
InChIKeySHAHPWSYJFYMRX-UHFFFAOYSA-N
SMILESCC(C1=CC=C(C=C1)CC2CCCC2O)C(=O)O

Computed by PubChem (NCBI)