CAS 83599-40-0 appears in our catalog under these names: Loxoprofen Impurity 35, 2-(4-((2-Hydroxycyclopentyl)methyl)phenyl)propanoic acid, 98%, 2-(4-((2-Hydroxycyclopentyl)methyl)phenyl)propanoic acid 98%, 4-[(2-Hydroxycyclopentyl)methyl]-a-methylbenzeneacetic acid, 98%, 98%. Offered by: Hubei YoungXin, Chemat Brand, Ambeed, Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request, 250mg.
2-[4-[(2-hydroxycyclopentyl)methyl]phenyl]propanoic acid (CAS 83599-40-0) is a chemical compound with the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. IUPAC name: 2-[4-[(2-hydroxycyclopentyl)methyl]phenyl]propanoic acid. InChIKey: SHAHPWSYJFYMRX-UHFFFAOYSA-N.
| Molecular formula | C15H20O3 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | 2-[4-[(2-hydroxycyclopentyl)methyl]phenyl]propanoic acid |
| InChIKey | SHAHPWSYJFYMRX-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)CC2CCCC2O)C(=O)O |
Computed by PubChem (NCBI)