CAS 25116-90-9 appears in our catalog under these names: N-(2,4-Dimethylphenyl)benzenesulfonamide, 95+%, 2',4'–DIMETHYLBENZENESULFONANILIDE. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 50mg.
N-(2,4-dimethylphenyl)benzenesulfonamide (CAS 25116-90-9) is a chemical compound with the molecular formula C14H15NO2S and a molecular weight of 261.34 g/mol. IUPAC name: N-(2,4-dimethylphenyl)benzenesulfonamide. InChIKey: ZEURMJNVUKYIFB-UHFFFAOYSA-N.
| Molecular formula | C14H15NO2S |
|---|---|
| Molecular weight | 261.34 g/mol |
| IUPAC name | N-(2,4-dimethylphenyl)benzenesulfonamide |
| InChIKey | ZEURMJNVUKYIFB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NS(=O)(=O)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)