Products 2512198-73-9
CAS 2512198-73-9 is the registry number for N,N-Diethyl-5-methyl-3-(nitromethyl)hexanamide. Offered by: TRC. Available pack sizes: 100mg, 25mg, 5mg.
N,N-diethyl-5-methyl-3-(nitromethyl)hexanamide (CAS 2512198-73-9) is a chemical compound with the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. IUPAC name: N,N-diethyl-5-methyl-3-(nitromethyl)hexanamide. InChIKey: WIININJVDXFOFA-UHFFFAOYSA-N.
| Molecular formula | C12H24N2O3 |
|---|---|
| Molecular weight | 244.33 g/mol |
| IUPAC name | N,N-diethyl-5-methyl-3-(nitromethyl)hexanamide |
| InChIKey | WIININJVDXFOFA-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)CC(CC(C)C)C[N+](=O)[O-] |
Computed by PubChem (NCBI)