Products 2512219-05-3
CAS 2512219-05-3 is the registry number for tert-butyl (5R)-5-methyl-2,7-diazaspiro[3.5]nonane-7-carboxylate hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl (5R)-5-methyl-2,7-diazaspiro[3.5]nonane-7-carboxylate;hydrochloride (CAS 2512219-05-3) is a chemical compound with the molecular formula C13H25ClN2O2 and a molecular weight of 276.80 g/mol. IUPAC name: tert-butyl (5R)-5-methyl-2,7-diazaspiro[3.5]nonane-7-carboxylate;hydrochloride. InChIKey: RIMWWSBPAUBQIC-PPHPATTJSA-N.
| Molecular formula | C13H25ClN2O2 |
|---|---|
| Molecular weight | 276.80 g/mol |
| IUPAC name | tert-butyl (5R)-5-methyl-2,7-diazaspiro[3.5]nonane-7-carboxylate;hydrochloride |
| InChIKey | RIMWWSBPAUBQIC-PPHPATTJSA-N |
| SMILES | C[C@H]1CN(CCC12CNC2)C(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)