Products 251300-32-0
CAS 251300-32-0 appears in our catalog under these names: 2–Hydroxy–3–(trifluoromethyl)benzoic acid, 2-Hydroxy-3-(trifluoromethyl)benzoic acid, 2-Hydroxy-3-(trifluoromethyl)benzoic acid, 95%, 95%, 2-Hydroxy-3-(trifluoromethyl)benzoic acid, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 2,5g, 1g, 5g, 10g, 25g.
2-hydroxy-3-(trifluoromethyl)benzoic acid (CAS 251300-32-0) is a chemical compound with the molecular formula C8H5F3O3 and a molecular weight of 206.12 g/mol. IUPAC name: 2-hydroxy-3-(trifluoromethyl)benzoic acid. InChIKey: OLLHFGFVHWLQJO-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O3 |
|---|---|
| Molecular weight | 206.12 g/mol |
| IUPAC name | 2-hydroxy-3-(trifluoromethyl)benzoic acid |
| InChIKey | OLLHFGFVHWLQJO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C(F)(F)F)O)C(=O)O |
Computed by PubChem (NCBI)