Products 251352-64-4
CAS 251352-64-4 appears in our catalog under these names: 1-(2-Chlorophenyl)-2,2,2-trifluoroethan-1-ol, 95%, 1-(2-Chlorophenyl)-2,2,2-trifluoroethanol, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 1g, 100mg, 250mg.
1-(2-chlorophenyl)-2,2,2-trifluoroethanol (CAS 251352-64-4) is a chemical compound with the molecular formula C8H6ClF3O and a molecular weight of 210.58 g/mol. IUPAC name: 1-(2-chlorophenyl)-2,2,2-trifluoroethanol. InChIKey: HCCWDTPILJKWCQ-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3O |
|---|---|
| Molecular weight | 210.58 g/mol |
| IUPAC name | 1-(2-chlorophenyl)-2,2,2-trifluoroethanol |
| InChIKey | HCCWDTPILJKWCQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(F)(F)F)O)Cl |
Computed by PubChem (NCBI)