Products 2514608-09-2
CAS 2514608-09-2 is the registry number for (R)-3,3-Difluoropiperidine-4-carboxylic Acid Hydrochloride, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(4R)-3,3-difluoropiperidine-4-carboxylic acid;hydrochloride (CAS 2514608-09-2) is a chemical compound with the molecular formula C6H10ClF2NO2 and a molecular weight of 201.60 g/mol. IUPAC name: (4R)-3,3-difluoropiperidine-4-carboxylic acid;hydrochloride. InChIKey: KLTNSWQCMQTWFW-PGMHMLKASA-N.
| Molecular formula | C6H10ClF2NO2 |
|---|---|
| Molecular weight | 201.60 g/mol |
| IUPAC name | (4R)-3,3-difluoropiperidine-4-carboxylic acid;hydrochloride |
| InChIKey | KLTNSWQCMQTWFW-PGMHMLKASA-N |
| SMILES | C1CNCC([C@H]1C(=O)O)(F)F.Cl |
Computed by PubChem (NCBI)