Products 2514944-45-5
CAS 2514944-45-5 appears in our catalog under these names: Diallyl Phthalate-d4, >95% (HPLC), Diallyl Phthalate-3,4,5,6-d4, 99 atom % D, min 97% Chemical Purity, Diallyl phthalate-d4. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 100mg, 10mg, 0,1g, 0,05g, 100 mg, 10 mg.
Bis(prop-2-enyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate (CAS 2514944-45-5) is a chemical compound with the molecular formula C14H14O4 and a molecular weight of 250.28 g/mol. IUPAC name: bis(prop-2-enyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate. InChIKey: QUDWYFHPNIMBFC-KDWZCNHSSA-N.
| Molecular formula | C14H14O4 |
|---|---|
| Molecular weight | 250.28 g/mol |
| IUPAC name | bis(prop-2-enyl) 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate |
| InChIKey | QUDWYFHPNIMBFC-KDWZCNHSSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)OCC=C)C(=O)OCC=C)[2H])[2H] |
Computed by PubChem (NCBI)