CAS 2517378-96-8 is the registry number for Lidocaine-d6 (hydrochloride). Offered by: Chemat, MedChemExpress. Available pack sizes: 1mg, 1 mg.
N-[2,6-bis(trideuteriomethyl)phenyl]-2-(diethylamino)acetamide;hydrochloride (CAS 2517378-96-8) is a chemical compound with the molecular formula C14H23ClN2O and a molecular weight of 276.83 g/mol. IUPAC name: N-[2,6-bis(trideuteriomethyl)phenyl]-2-(diethylamino)acetamide;hydrochloride. InChIKey: IYBQHJMYDGVZRY-SKCUOGQWSA-N.
| Molecular formula | C14H23ClN2O |
|---|---|
| Molecular weight | 276.83 g/mol |
| IUPAC name | N-[2,6-bis(trideuteriomethyl)phenyl]-2-(diethylamino)acetamide;hydrochloride |
| InChIKey | IYBQHJMYDGVZRY-SKCUOGQWSA-N |
| SMILES | [2H]C([2H])([2H])C1=C(C(=CC=C1)C([2H])([2H])[2H])NC(=O)CN(CC)CC.Cl |
Computed by PubChem (NCBI)