CAS 77966-82-6 is the registry number for Lidocaine Impurity 7 HCl. Offered by: Chemat Brand. Available pack sizes: on request.
[2-(3,5-dimethylanilino)-2-oxoethyl]-diethylazanium chloride (CAS 77966-82-6) is a chemical compound with the molecular formula C14H23ClN2O and a molecular weight of 270.80 g/mol. IUPAC name: [2-(3,5-dimethylanilino)-2-oxoethyl]-diethylazanium chloride. InChIKey: KKVXWBSRZDNRGG-UHFFFAOYSA-N.
| Molecular formula | C14H23ClN2O |
|---|---|
| Molecular weight | 270.80 g/mol |
| IUPAC name | [2-(3,5-dimethylanilino)-2-oxoethyl]-diethylazanium chloride |
| InChIKey | KKVXWBSRZDNRGG-UHFFFAOYSA-N |
| SMILES | CC[NH+](CC)CC(=O)NC1=CC(=CC(=C1)C)C.[Cl-] |
Computed by PubChem (NCBI)