Products 77966-82-6

CAS 77966-82-6 is the registry number for Lidocaine Impurity 7 HCl. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

[2-(3,5-dimethylanilino)-2-oxoethyl]-diethylazanium chloride (CAS 77966-82-6) is a chemical compound with the molecular formula C14H23ClN2O and a molecular weight of 270.80 g/mol. IUPAC name: [2-(3,5-dimethylanilino)-2-oxoethyl]-diethylazanium chloride. InChIKey: KKVXWBSRZDNRGG-UHFFFAOYSA-N.

Identity
Molecular formulaC14H23ClN2O
Molecular weight270.80 g/mol
IUPAC name[2-(3,5-dimethylanilino)-2-oxoethyl]-diethylazanium chloride
InChIKeyKKVXWBSRZDNRGG-UHFFFAOYSA-N
SMILESCC[NH+](CC)CC(=O)NC1=CC(=CC(=C1)C)C.[Cl-]

Computed by PubChem (NCBI)