CAS 857170-72-0 appears in our catalog under these names: 2-(Diethylamino)-N-(2,3-dimethylphenyl)acetamide hydrochloride, 95+%, Lidocaine Impurity F（EP）, Lidocaine EP Impurity F HCl, 2-(Diethylamino)-N-(2,3-dimethylphenyl)acetamide Hydrochloride, >95% (HPLC), 2-(Diethylamino)-N-(2,3-dimethylphenyl)acetamide Hydrochloride. Offered by: Chemat Brand, TRC, Mikromol, Biosynth, Chemat. Available pack sizes: on request, 2,5g, 250mg, 4x25mg, 25mg, 500mg, 1000mg, 2000mg.
2-(diethylamino)-N-(2,3-dimethylphenyl)acetamide;hydrochloride (CAS 857170-72-0) is a chemical compound with the molecular formula C14H23ClN2O and a molecular weight of 270.80 g/mol. IUPAC name: 2-(diethylamino)-N-(2,3-dimethylphenyl)acetamide;hydrochloride. InChIKey: JNOMHDCAYOQVAC-UHFFFAOYSA-N.
| Molecular formula | C14H23ClN2O |
|---|---|
| Molecular weight | 270.80 g/mol |
| IUPAC name | 2-(diethylamino)-N-(2,3-dimethylphenyl)acetamide;hydrochloride |
| InChIKey | JNOMHDCAYOQVAC-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC(=O)NC1=CC=CC(=C1C)C.Cl |
Computed by PubChem (NCBI)