CAS 1012864-23-1 appears in our catalog under these names: 2-(Diethylamino)-n-(2,5-dimethylphenyl)acetamide hydrochloride, 95%, Lidocaine EP Impurity J HCl, Lidocaine Impurity J(EP), 2-(Diethylamino)-N-(2,5-dimethylphenyl)acetamide Hydrochloride, >95% (HPLC), 2-(Diethylamino)-N-(2,5-dimethylphenyl)acetamide Hydrochloride. Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, GLPBio. Available pack sizes: 100mg, on request, 2,5g, 250mg, 25mg, 50mg.
2-(diethylamino)-N-(2,5-dimethylphenyl)acetamide;hydrochloride (CAS 1012864-23-1) is a chemical compound with the molecular formula C14H23ClN2O and a molecular weight of 270.80 g/mol. IUPAC name: 2-(diethylamino)-N-(2,5-dimethylphenyl)acetamide;hydrochloride. InChIKey: HPSKXAHVFGEADX-UHFFFAOYSA-N.
| Molecular formula | C14H23ClN2O |
|---|---|
| Molecular weight | 270.80 g/mol |
| IUPAC name | 2-(diethylamino)-N-(2,5-dimethylphenyl)acetamide;hydrochloride |
| InChIKey | HPSKXAHVFGEADX-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC(=O)NC1=C(C=CC(=C1)C)C.Cl |
Computed by PubChem (NCBI)