CAS 2519585-99-8 is the registry number for 3-Bromopyrimido[1,2-b]indazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3-bromopyrimido[1,2-b]indazole (CAS 2519585-99-8) is a chemical compound with the molecular formula C10H6BrN3 and a molecular weight of 248.08 g/mol. IUPAC name: 3-bromopyrimido[1,2-b]indazole. InChIKey: JZKCBGXPKXEXNX-UHFFFAOYSA-N.
| Molecular formula | C10H6BrN3 |
|---|---|
| Molecular weight | 248.08 g/mol |
| IUPAC name | 3-bromopyrimido[1,2-b]indazole |
| InChIKey | JZKCBGXPKXEXNX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3N=CC(=CN3N=C2C=C1)Br |
Computed by PubChem (NCBI)