CAS 25198-03-2 appears in our catalog under these names: 7-Methoxy-L-Tryptophan, H-Trp(7-OMe)-OH 95%, (S)-2-Amino-3-(7-methoxy-1H-indol-3-yl)propanoic acid, 95%, 95%. Offered by: TRC, Ambeed, Chemat. Available pack sizes: 250mg, 5g, 100mg, 1g.
(2S)-2-amino-3-(7-methoxy-1H-indol-3-yl)propanoic acid (CAS 25198-03-2) is a chemical compound with the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. IUPAC name: (2S)-2-amino-3-(7-methoxy-1H-indol-3-yl)propanoic acid. InChIKey: MUZROTSTMQSBFK-VIFPVBQESA-N.
| Molecular formula | C12H14N2O3 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | (2S)-2-amino-3-(7-methoxy-1H-indol-3-yl)propanoic acid |
| InChIKey | MUZROTSTMQSBFK-VIFPVBQESA-N |
| SMILES | COC1=CC=CC2=C1NC=C2C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)