CAS 25255-56-5 appears in our catalog under these names: methyl 2,2-dimethyl-3-[(4-methylbenzenesulfonyl)oxy]propanoate, 96%, 96%, Methyl 2,2-dimethyl-3-(tosyloxy)propanoate, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl 2,2-dimethyl-3-(4-methylphenyl)sulfonyloxypropanoate (CAS 25255-56-5) is a chemical compound with the molecular formula C13H18O5S and a molecular weight of 286.35 g/mol. IUPAC name: methyl 2,2-dimethyl-3-(4-methylphenyl)sulfonyloxypropanoate. InChIKey: QDTQEKSCNKGNCD-UHFFFAOYSA-N.
| Molecular formula | C13H18O5S |
|---|---|
| Molecular weight | 286.35 g/mol |
| IUPAC name | methyl 2,2-dimethyl-3-(4-methylphenyl)sulfonyloxypropanoate |
| InChIKey | QDTQEKSCNKGNCD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC(C)(C)C(=O)OC |
Computed by PubChem (NCBI)