CAS 252561-81-2 appears in our catalog under these names: 2'-Chloro-4'-bromoacetophenone, 97%, 97%, 1-(4-Bromo-2-chlorophenyl)ethanone 97%, 1-(4-Bromo-2-chlorophenyl)ethanone, 95%. Offered by: Chemat, Ambeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 500g.
1-(4-bromo-2-chlorophenyl)ethanone (CAS 252561-81-2) is a chemical compound with the molecular formula C8H6BrClO and a molecular weight of 233.49 g/mol. IUPAC name: 1-(4-bromo-2-chlorophenyl)ethanone. InChIKey: QYKIWOVJASCUBH-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO |
|---|---|
| Molecular weight | 233.49 g/mol |
| IUPAC name | 1-(4-bromo-2-chlorophenyl)ethanone |
| InChIKey | QYKIWOVJASCUBH-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(C=C1)Br)Cl |
Computed by PubChem (NCBI)