CAS 252562-28-0 appears in our catalog under these names: 3-(4-Bromophenyl)-N,N-dimethylacrylamide, 97%, 1-(4-Bromo-phenyl)-3-dimethylamino-propenone, 97%. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g, 5g, 25g.
(Z)-1-(4-bromophenyl)-3-(dimethylamino)prop-2-en-1-one (CAS 252562-28-0) is a chemical compound with the molecular formula C11H12BrNO and a molecular weight of 254.12 g/mol. IUPAC name: (Z)-1-(4-bromophenyl)-3-(dimethylamino)prop-2-en-1-one. InChIKey: IGZLESKZUATMSD-FPLPWBNLSA-N.
| Molecular formula | C11H12BrNO |
|---|---|
| Molecular weight | 254.12 g/mol |
| IUPAC name | (Z)-1-(4-bromophenyl)-3-(dimethylamino)prop-2-en-1-one |
| InChIKey | IGZLESKZUATMSD-FPLPWBNLSA-N |
| SMILES | CN(C)/C=C\C(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)