CAS 252873-35-1 is the registry number for (3R,3aS,6aR)-Hexahydrofuro(2,3-b)furan-3-yl (4-nitrophenyl) Carbonate. Offered by: TRC. Available pack sizes: 1g.
[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] (4-nitrophenyl) carbonate (CAS 252873-35-1) is a chemical compound with the molecular formula C13H13NO7 and a molecular weight of 295.24 g/mol. IUPAC name: [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] (4-nitrophenyl) carbonate. InChIKey: ULTSJNOQNKVDBM-SDDRHHMPSA-N.
| Molecular formula | C13H13NO7 |
|---|---|
| Molecular weight | 295.24 g/mol |
| IUPAC name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] (4-nitrophenyl) carbonate |
| InChIKey | ULTSJNOQNKVDBM-SDDRHHMPSA-N |
| SMILES | C1CO[C@H]2[C@@H]1[C@H](CO2)OC(=O)OC3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)