CAS 25288-76-0 appears in our catalog under these names: 3-Dibenzothiophenamine, 97%, 97%, Dibenzo[b,d]thiophen-3-amine, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 25g.
Dibenzothiophen-3-amine (CAS 25288-76-0) is a chemical compound with the molecular formula C12H9NS and a molecular weight of 199.27 g/mol. IUPAC name: dibenzothiophen-3-amine. InChIKey: HSIYJKUTMUOWPE-UHFFFAOYSA-N.
| Molecular formula | C12H9NS |
|---|---|
| Molecular weight | 199.27 g/mol |
| IUPAC name | dibenzothiophen-3-amine |
| InChIKey | HSIYJKUTMUOWPE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(S2)C=C(C=C3)N |
Computed by PubChem (NCBI)