Products 253324-72-0
CAS 253324-72-0 is the registry number for 2-(3,5-Difluorophenyl)-2-methoxyacetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(3,5-difluorophenyl)-2-methoxyacetic acid (CAS 253324-72-0) is a chemical compound with the molecular formula C9H8F2O3 and a molecular weight of 202.15 g/mol. IUPAC name: 2-(3,5-difluorophenyl)-2-methoxyacetic acid. InChIKey: ZGAAFRQSQHBMLM-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O3 |
|---|---|
| Molecular weight | 202.15 g/mol |
| IUPAC name | 2-(3,5-difluorophenyl)-2-methoxyacetic acid |
| InChIKey | ZGAAFRQSQHBMLM-UHFFFAOYSA-N |
| SMILES | COC(C1=CC(=CC(=C1)F)F)C(=O)O |
Computed by PubChem (NCBI)