Products 25368-01-8
CAS 25368-01-8 appears in our catalog under these names: Litseglutine B, Litseglutine B, ≥95%. Offered by: MedChemExpress, Chemat. Available pack sizes: Get quote, 5mg.
(6aS)-1,10,11-trimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-2-ol (CAS 25368-01-8) is a chemical compound with the molecular formula C20H23NO4 and a molecular weight of 341.4 g/mol. IUPAC name: (6aS)-1,10,11-trimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-2-ol. InChIKey: MMPSCNRRQGVBGG-ZDUSSCGKSA-N.
| Molecular formula | C20H23NO4 |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | (6aS)-1,10,11-trimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-2-ol |
| InChIKey | MMPSCNRRQGVBGG-ZDUSSCGKSA-N |
| SMILES | CN1CCC2=CC(=C(C3=C2[C@@H]1CC4=C3C(=C(C=C4)OC)OC)OC)O |
Computed by PubChem (NCBI)
Synonyms:
Litseglutine B, orb1682205