Products 2538-61-6

CAS 2538-61-6 appears in our catalog under these names: 2,6-Dimethylphenylhydrazine hydrochloride, 98%, (2,6-Dimethylphenyl)hydrazine hydrochloride 97%, 2,6-Dimethylphenylhydrazine hydrochloride, 97%, 97%, 2,6-Dimethylphenylhydrazine hydrochloride, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 1g, 500g, 5g, 10g.

Structural formula: {0} (CAS {1})

(2,6-dimethylphenyl)hydrazine;hydrochloride (CAS 2538-61-6) is a chemical compound with the molecular formula C8H13ClN2 and a molecular weight of 172.65 g/mol. IUPAC name: (2,6-dimethylphenyl)hydrazine;hydrochloride. InChIKey: GQKQMDUOOZVZFD-UHFFFAOYSA-N.

Identity
Molecular formulaC8H13ClN2
Molecular weight172.65 g/mol
IUPAC name(2,6-dimethylphenyl)hydrazine;hydrochloride
InChIKeyGQKQMDUOOZVZFD-UHFFFAOYSA-N
SMILESCC1=C(C(=CC=C1)C)NN.Cl

Computed by PubChem (NCBI)