CAS 339312-61-7 appears in our catalog under these names: (S)-1-(Pyridin-2-yl)propan-1-amine hydrochloride, 95%, (S)-1-(Pyridin-2-yl)propan-1-amine dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
(1S)-1-pyridin-2-ylpropan-1-amine;hydrochloride (CAS 339312-61-7) is a chemical compound with the molecular formula C8H13ClN2 and a molecular weight of 172.65 g/mol. IUPAC name: (1S)-1-pyridin-2-ylpropan-1-amine;hydrochloride. InChIKey: HNBBNBYPDZDRTG-FJXQXJEOSA-N.
| Molecular formula | C8H13ClN2 |
|---|---|
| Molecular weight | 172.65 g/mol |
| IUPAC name | (1S)-1-pyridin-2-ylpropan-1-amine;hydrochloride |
| InChIKey | HNBBNBYPDZDRTG-FJXQXJEOSA-N |
| SMILES | CC[C@@H](C1=CC=CC=N1)N.Cl |
Computed by PubChem (NCBI)