Products 26177-51-5
CAS 26177-51-5 appears in our catalog under these names: (4-Methylbenzyl)hydrazine hydrochloride, 95%, (4-Methylbenzyl)hydrazine hydrochloride, 97%, (4-Methylbenzyl)hydrazine hydrochloride, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100g, 100mg, 250mg, 10g, 25g.
[(4-methylphenyl)methylamino]azanium chloride (CAS 26177-51-5) is a chemical compound with the molecular formula C8H13ClN2 and a molecular weight of 172.65 g/mol. IUPAC name: [(4-methylphenyl)methylamino]azanium chloride. InChIKey: FZDQALMNASCCIY-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN2 |
|---|---|
| Molecular weight | 172.65 g/mol |
| IUPAC name | [(4-methylphenyl)methylamino]azanium chloride |
| InChIKey | FZDQALMNASCCIY-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)CN[NH3+].[Cl-] |
Computed by PubChem (NCBI)