Products 56737-78-1

CAS 56737-78-1 appears in our catalog under these names: 2,5-Dimethylphenylhydrazine hydrochloride, 98%, 2,5–Dimethylphenylhydrazine hydrochloride, 2,5-Dimethylphenylhydrazine hydrochloride, 2,5-Dimethylphenylhydrazine hydrochloride, 95%, 95%, 2,5-Dimethylphenylhydrazine hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 500g.

Structural formula: {0} (CAS {1})

(2,5-dimethylphenyl)hydrazine;hydrochloride (CAS 56737-78-1) is a chemical compound with the molecular formula C8H13ClN2 and a molecular weight of 172.65 g/mol. IUPAC name: (2,5-dimethylphenyl)hydrazine;hydrochloride. InChIKey: OMOFMSZLYCEIAF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H13ClN2
Molecular weight172.65 g/mol
IUPAC name(2,5-dimethylphenyl)hydrazine;hydrochloride
InChIKeyOMOFMSZLYCEIAF-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)C)NN.Cl

Computed by PubChem (NCBI)