Products 25384-75-2

CAS 25384-75-2 is the registry number for Carisoprodol Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

[2-(carbamoyloxymethyl)-2-methylpentyl] N-ethylcarbamate (CAS 25384-75-2) is a chemical compound with the molecular formula C11H22N2O4 and a molecular weight of 246.30 g/mol. IUPAC name: [2-(carbamoyloxymethyl)-2-methylpentyl] N-ethylcarbamate. InChIKey: LORFBSZZGKKTAK-UHFFFAOYSA-N.

Identity
Molecular formulaC11H22N2O4
Molecular weight246.30 g/mol
IUPAC name[2-(carbamoyloxymethyl)-2-methylpentyl] N-ethylcarbamate
InChIKeyLORFBSZZGKKTAK-UHFFFAOYSA-N
SMILESCCCC(C)(COC(=O)N)COC(=O)NCC

Computed by PubChem (NCBI)