CAS 25456-86-4 appears in our catalog under these names: H–Asn–OtBu, H-L-Asn-OtBu, H-Asn-OtBu 95%, L-Asparagine tert-Butyl Ester, 95%, 95%, H-Asn-OtBu, 98%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 10g, 25g, 100g, 250mg.
Tert-butyl (2S)-2,4-diamino-4-oxobutanoate (CAS 25456-86-4) is a chemical compound with the molecular formula C8H16N2O3 and a molecular weight of 188.22 g/mol. IUPAC name: tert-butyl (2S)-2,4-diamino-4-oxobutanoate. InChIKey: VLLGKVRQXXHELH-YFKPBYRVSA-N.
| Molecular formula | C8H16N2O3 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | tert-butyl (2S)-2,4-diamino-4-oxobutanoate |
| InChIKey | VLLGKVRQXXHELH-YFKPBYRVSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CC(=O)N)N |
Computed by PubChem (NCBI)