Products 25462-84-4

CAS 25462-84-4 appears in our catalog under these names: 2–Bromo–6–methylisonicotinic acid, 2-Bromo-6-methylisonicotinic acid, 2-Bromo-6-methylisonicotinic acid 95%, 2-BROMO-6-METHYLISONICOTINIC ACID, 95%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem. Available pack sizes: 100mg, 10g, 1g, 250mg, 5g.

Structural formula: {0} (CAS {1})

2-bromo-6-methylpyridine-4-carboxylic acid (CAS 25462-84-4) is a chemical compound with the molecular formula C7H6BrNO2 and a molecular weight of 216.03 g/mol. IUPAC name: 2-bromo-6-methylpyridine-4-carboxylic acid. InChIKey: QGZZJQDQHFJUHC-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6BrNO2
Molecular weight216.03 g/mol
IUPAC name2-bromo-6-methylpyridine-4-carboxylic acid
InChIKeyQGZZJQDQHFJUHC-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=N1)Br)C(=O)O

Computed by PubChem (NCBI)